Answer please I’m stuck

Answer Please Im Stuck

Answers

Answer 1

Answer:

196

Step-by-step explanation:

We will use the formula:

Surface Area of A / Surface area of B = (Height of A /Height of B)^2

49/S2 = (4/8)^2

49/S2 = 1/4

S2 = 196

Answred by Gauthmath


Related Questions


I need help answering this ASAP

Answers

Answer:

A

Step-by-step explanation:

The graph is a square root function

GIVING 25 POINTS AND BRAINIER IF ANSWERED!

What is one thing you would not do when finding the question in a word problem?
A. Look for a problem similar to the word problem you are trying to solve.
B. The question may not be directly stated.
C. So you can understand what the facts are in the word problem.
D. To define your strategy or game plan to solve the word problem.

Answers

The answer to your question is A

Answer:

B. The question may not be directly stated.

Which of the following questions are equivalent to the answer below x 3/5

Answers

Answer:

[tex]x^\frac{3}{5} = (x^3 )^\frac{1}{5}[/tex]

[tex]x^\frac{3}{5} = \sqrt[5]{x^3}[/tex]

[tex]x^\frac{3}{5} = (\sqrt[5]{x})^3[/tex]

Step-by-step explanation:

Given

[tex]x^\frac{3}{5}[/tex]

Required

The equivalent expressions

We have:

[tex]x^\frac{3}{5}[/tex]

Expand the exponent

[tex]x^\frac{3}{5} = x^{ 3 * \frac{1}{5}}[/tex]

So, we have:

[tex]x^\frac{3}{5} = (x^3 )^\frac{1}{5}[/tex] ----- this is equivalent

Express 1/5 as roots (law of indices)

[tex]x^\frac{3}{5} = \sqrt[5]{x^3}[/tex] ------ this is equivalent

The above can be rewritten as:

[tex]x^\frac{3}{5} = (\sqrt[5]{x})^3[/tex] ------ this is equivalent

18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?

acute

obtuse

equiangular

right

Answers

Answer:

obtuse                    

aniuhafjhnfajfnha

What is the value of x in the equation 5(3x + 4) = 23?

Answers

Answer:

x = 1/5

Step-by-step explanation:

5(3x + 4) = 23

Distribute

15x+20 = 23

Subtract 20 from each side

15x+20-20 = 23-20

15x = 3

Divide by 15

15x/15 = 3/15

x = 1/5

Answer:

[tex]x = 0.2[/tex]

Step-by-step explanation:

Step 1:  Distribute

[tex]5(3x + 4) = 23[/tex]

[tex](5 * 3x) + (5 * 4) = 23[/tex]

[tex](15x) + 20 = 23[/tex]

Step 2:  Subtract 20 from both sides

[tex](15x) + 20 - 20 = 23 - 20[/tex]

[tex]15x = 3[/tex]

Step 3:  Divide both sides by 15

[tex]\frac{15x}{15} = \frac{3}{15}[/tex]

[tex]x = \frac{1}{5}[/tex]

[tex]x = 0.2[/tex]

Answer:  [tex]x = 0.2[/tex]

Two chords in a circle intersect. One chord is made of 6 and 5, and the other is made of x +1 and x. What is x?

Answers

Answer:

x = 5 and -6

Step-by-step explanation:

Using the intersecting chord theorem which states that the products of the lengths of the line segments on each chord are equal.

Hence:

let

a = 6, b = 5, c = x+1 and d = x

Therefore, ab = cd

6*5 = x(x+1)

30 = x²+x

x²+x - 30 = 0

x²+ 6x - 5x - 30 = 0

x(x+6) - 5(x+6) =0

(x-5)(x+6) = 0

x-5 =0 and x+6 = 0

x = 5 and -6

The number N(t) of supermarkets throughout the country that are using a computerized checkout system is described by the initial-value problem

dN/dt = N(1 − 0.0008N), N(0) = 1.

Required:
Predict how many supermarkets are expected to adopt the new procedure over a long period of time?

Answers

Answer:

1250 supermarkets

Step-by-step explanation:

Given

[tex]\frac{dN}{dt} = N(1 - 0.0008N)[/tex]

[tex]N(0) = 1[/tex]

Required

Number of supermarkets over a long period of time

To do this, we simply set

[tex]\frac{dN}{dt} = 0[/tex]

So, we have:

[tex]N(1 - 0.0008N) = 0[/tex]

Split

[tex]N = 0\ or\ 1 - 0.0008N = 0[/tex]

Solve: [tex]1 - 0.0008N = 0[/tex]

Collect like terms

[tex]0.0008N = 1[/tex]

Make N the subject

[tex]N = \frac{1}{0.0008}[/tex]

[tex]N = 1250[/tex]

So:

[tex]\lim_{t \to \infty} N(t) = 1250[/tex]

rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible​

Answers

= 2025

When you are told to find the smallest length possible, you perform L.C.M(Least common multiples)

For this, you divide the given lengths using the numbers that divides all through.

I have added an image to this answer. Go through it for more explanation

The diameter of a regulation soccer ball is about 8 and three-fifths inches. This number was graphed on a number line.

A number line going from negative 9 to positive 9. Point A is between negative 9 and negative 8, point B is between negative 7 and negative 6, point C is between 6 and 7, point D is between 8 and 9.

Which point could be the point representing the graph of the diameter of the ball?
A
B
C
D

Answers

Answer:

D

Step-by-step explanation:

8 and 3/5 = 8.2 and 8.2 is between 8 and 9 so the answer is D.

Help me! Thanks!!!!!!

Answers

Answer:

there are infinite solutions

Step-by-step explanation:

if you add y-3 to both sides of the first equation, you will see that it is equal to the second equation, so they are the same line. Therefore, there are infinite solutions to this system

What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid?

Answers

Answer:

17 units

Step-by-step explanation:

Use the distance formula, [tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]

Plug in the points and simplify:

[tex]d = \sqrt{(x_2 - x_1)^2 + (y_2-y_1)^2}[/tex]

[tex]d = \sqrt{(-8 - 7)^2 + (0-8)^2}[/tex]

[tex]d = \sqrt{(-15)^2 + (-8)^2}[/tex]

[tex]d = \sqrt{225 + 64[/tex]

[tex]d = \sqrt{289[/tex]

[tex]d = 17[/tex]

So, the distance between the points is 17 units

Help please ….. help

Answers

Answer:

Step-by-step explanation:

a) categorical

b) add all of the numbers and divide by how many numbers there were.

c) outliers means any that were far away from the rest of the data

d) not entirely, you can make an estimate based on it, but nat an exact answer.

Using the following system of equations to help, what is the value of x-2y?
3x + 2y =48
2x +3y =12
Please help.

Answers

X - Y = 36 -> X = 36+ Y
3X + 2Y = 48 -> 3(36+Y)+2Y= 48-> Y = -12
X = 36-12= 24
X -2Y= 24-2.(-12) = 48

.
.
.
.
.
.
.
.
.
.
.
“””” HELP PLEASE “”””
.
.
.
.
.
.
.
.
.
.
.

Answers

9514 1404 393

Answer:

  x = 14 cm

Step-by-step explanation:

We can only solve for x if the triangles are similar. The arrows on the left and right legs say those are parallel. Since alternate interior angles at each of the transversals are congruent, the triangles are AA similar.

ΔABC ~ ΔDEC, so we have ...

  EC/ED = BC/BA

  x/(18 cm) = (35 cm)/(45 cm)

  x = (18 cm)(7/9) = 14 cm

How would the following triangle be classified?
O scalene acute
O scalene obtuse
O isosceles acute
O isosceles obtuse

Answers

Answer:

isosceles acute

Step-by-step explanation:

We have two sides that are equal so the triangle is isosceles

None of the angles are larger than 90 degrees so non of the angles are obtuse,  and none of the angles are 90 degrees, so the triangle is acute ( which means the angles are all less than 90 degrees)

Please send only answer
Want to bring a metal rod to assemble a toy frame. All long metal rods must be used at least. How much to assemble the frame as shown in the picture

Answers

Answer:

how many times should u use the metal rod ??

Enter the solutions from least to greatest.
f(x) = (x – 3)(2x – 8)

Answers

Answer:

The zeroes of the function are: 3 and 4

Step-by-step explanation:

1. You are given the 3rd and 5th term of an arithmetic sequence. Describe in words how to determine the general term.

2. You are given the 3rd and 5th term of an geometric sequence. Describe how to determine the 10th term without finding the general term.

Answers

Step-by-step explanation:

1. In an arithmetic sequence, the general term can be written as

xₙ = y + d(a-1), where xₐ represents the ath term, y is the first value, and d is the common difference.

Given the third term and the fifth term, and knowing that the difference between each term is d, we can say that the 4th term is x₃+d and the fifth term is the fourth term plus d, or (x₃+d)+d =

x₃+2d. =x₅ Given x₃ and x₅, we can subtract x₃ from both sides to get

x₅-x₃ = 2d

divide by 2 to isolate d

(x₅-x₃)/2 = d

This lets us solve for d. Given d, we can say that

x₃ = y+d(2)

subtract 2*d from both sides to isolate the y

x₃ -2*d = y

Therefore, because we know x₃ and d at this point, we can solve for y, letting us plug y and d into our original equation of

xₙ = y + d(a-1)

2.

Given the third and fifth term, with a common ratio of r, we can say that the fourth term is x₃ * r. Then, the fifth term is

x₃* r * r

= x₃*r² = x₅

divide both sides by x₃ to isolate the r²

x₅/x₃ = r²

square root both sides

√(x₅/x₃) = ±r

One thing that is important to note is that we don't know whether r is positive or negative. For example, if x₃ = 4 and x₅ = 16, regardless of whether r is equal to 2 or -2, 4*r² = 16. I will be assuming that r is positive for this question.

Given the common ratio, we can find x₆ as x₅ * r, x₇ as x₅*r², and all the way up to x₁₀ = x₅*r⁵. We don't know the general term, but can still find the tenth term of the sequence

PLEASE HELP ASAP!!!!!

Answers

Step-by-step explanation:

Area ABC=1/2ab×sin C

=1/2 ×20×10 ×Sin C

Sin C =100

0.5 kilograms (kg) is equal to how many ounces? Round your answer to the

Answers

Answer:

17.637 ounces

Step-by-step explanation:

35.274 ounces is 1 kilogram so divide 35.274 by 2

Might want to keep the other guy Brainly

find the missing side length below brainly

Answers

Let it be x

[tex]\\ \sf\longmapsto \dfrac{3}{5}=\dfrac{x}{x+4}[/tex]

[tex]\\ \sf\longmapsto 3(x+4)=5x[/tex]

[tex]\\ \sf\longmapsto 3x+12=5x[/tex]

[tex]\\ \sf\longmapsto 5x-3x=12[/tex]

[tex]\\ \sf\longmapsto 2x=12[/tex]

[tex]\\ \sf\longmapsto x=\dfrac{12}{2}[/tex]

[tex]\\ \sf\longmapsto x=6[/tex]

The function below models the correlation between the number of hours a plant is kept in sunlight (x) and the height (y), in mm, to which it grows: y = 2 + 4x What does the y-intercept of this function represent? (1 point) The original height of the plant was 4 mm. The original height of the plant was 2 mm. The height of the plant increases by 2 mm for every hour of sunlight it receives. The height of the plant increases by 4 mm for every hour of sunlight it receives.

Answers

Answer:

The original height of the plant was 2 mm

Step-by-step explanation:

Given

[tex]y = 2 + 4x[/tex]

Required

Interpret the y-intercept

The y-intercept is when [tex]x = 0[/tex]

So, we have:

[tex]y = 2 + 4 *0[/tex]

[tex]y = 2 + 0[/tex]

[tex]y = 2[/tex]

This implies that the original or initial height was 2 mm

Two cars start moving from the same point. One travels south at 24 mi/h and the other travels west at 18 mi/h. At what rate (in mi/h) is the distance between the cars increasing two hours later

Answers

Answer:

The rate at which the distance between the two cars is increasing is 30 mi/h

Step-by-step explanation:

Given;

speed of the first car, v₁ = 24 mi/h

speed of the second car, v₂ = 18 mi/h

Two hours later, the position of the cars is calculated as;

position of the first car, d₁ = 24 mi/h  x 2 h  = 48 mi

position of the second car, d₂ = 18 mi/h  x 2 h = 36 mi

The displacement of the two car is calculated as;

displacement, d² = 48² + 36²

                        d² = 3600

                        d = √3600

                        d = 60 mi

The rate at which this displacement is changing = (60 mi) / (2h)

                                                                                 = 30 mi/h

the camdens drove 116 miles on 5 gallons of gas. at this rate, how many miles can they drive on 7 gallons of gas

Answers

Answer:

162.4 miles

Step-by-step explanation:

We can write a ratio to solve

116 miles            x miles

----------------- = ------------

5 gallons           7 gallons

Using cross products

116*7 = 5x

Divide by 5

812 /5 = 5x/5

162.4 =x

162.4 miles

sin(180+0).cos(180+0)/cos(180+0).sin(180-0)​

Answers

Sin(180+0).cos(180+0) = 0.479458
Cos(180+0).sin(180-0) = 0.479458
Final answer is = 1
Hope that help

A two-digit number is of the number
7
formed by reversing its digits. When the
number is increased by 2 times the sum of
its digits, it becomes 54. Find the number.

Answers

Answer:

C

Step-by-step explanation:

find the equation of straight line passes through point (3,1) such that the intercept on y-axis exceeds that on the x- axis by 4.



Answers

Answer:

Step-by-step explanation:

Assume a researcher wants to compare the mean Alanine Aminotransferase (ALT) levels in two populations, individuals who drink alcohol and individuals who do not drink alcohol. The mean ALT levels for the individuals who do not drink alcohol is 32 with a standard deviation of 14, and 37 individuals were in the sample. The mean ALT levels for individuals who drink alcohol is 69 with a standard deviation of 19, and 38 individuals were in the sample. Construct and interpret a 95% confidence interval demonstrating the difference in means for those individuals who drink alcohol when compared to those who do not drink alcohol.
a. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.22 and 39.78.
b. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.33 and 39.67
c. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.32 and 39.68.
d. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.41 and 39.59.

Answers

Answer:

c. The researchers are 95% confident that the true mean difference in ALT values between the population of drinkers and population of non-drinkers is between 24.32 and 39.68.

Step-by-step explanation:

Given :

Groups:

x1 = 69 ; s1 = 19 ; n1 = 38

x2 = 32 ; s2 = 14 ; n2 = 37

1 - α = 1 - 0.95 = 0.05

Using a confidence interval calculator to save computation time, kindly plug the values into the calculator :

The confidence interval obtained is :

(24.32 ; 39.68) ; This means that we are 95% confident that the true mean difference in ALT values between the two population lies between

(24.32 ; 39.68) .

a coin is tossed succesively three times times . determine tje probabiliy of getting all three heads​

Answers

Answer:

Answer : 1/8.

Step-by-step explanation:

Hey there!

Please see the attached picture for your answer.

Hope it helps!

You measure 40 watermelons' weights, and find they have a mean weight of 67 ounces. Assume the population standard deviation is 11.4 ounces. Based on this, what is the maximal margin of error associated with a 99% confidence interval for the true population mean watermelon weight.

Answers

Answer:

[tex]35.36,44.64[/tex]

Step-by-step explanation:

Sample size [tex]n=40[/tex]

Mean weight [tex]\=x =67[/tex]

Standard deviation [tex]\sigma=11.4[/tex]

Confidence Interval [tex]CI=0.99[/tex]

\alpha==0.01

Therefore

[tex]Z_{\frac{\alpha}{2}}=Z_[0.005][/tex]

From table

[tex]Z_{\frac{\alpha}{2}}=2.576[/tex]

Generally, the equation for Margin of error is mathematically given by

[tex]M.E=Z_{\frac{\alpha}{2}}*(\frac{\sigma}{sqrt{n}}[/tex]

[tex]M.E=2.576*(\frac{11.4}{\sqrt{40}}[/tex]

[tex]M.E=4.64[/tex]

Therefore Estimated mean is

[tex]\=x-M.E<\mu <\=x +E[/tex]

[tex]40-4.64<\mu< 40+4.64[/tex]

[tex]35.36<\mu < 44.64[/tex]

[tex]35.36,44.64[/tex]

Other Questions
A team of 5people to be selected from 7women & 6men. Find the number of different teams that could be selected if there must be more women than men in the team how computer network reduce the cost of computer hardware? explain with example. Consider the reaction below. How much heat is absorbed if 5.00 moles of nitrogen reactwith excess oxygen?2 N2 (8) + O2(g) 2 N20 (8) AHrxn- +163.2 kJ If a negatively charged particle is placed inside a uniform electric field the electric force that will act on that particle points in what direction in reference to the electric field lines? A horse is running on a circular path with constant speed but its direction is changing at every point. It is Synovec Co. is growing quickly. Dividends are expected to grow at a rate of 24 percent for the next three years, with the growth rate falling off to a constant 7 percent thereafter. If the required return is 11 percent, and the company just paid a dividend of $2.05, what is the current share price Nam is interested _________ English and PhysicsA. toB. forC. atD.in A hot air balloon is released into the air. During its straight ascent, the angle of elevation was 15 and, 3 minutes later, the angle of elevation increased 20. How fast is the balloon traveling, in km/h, if the angle measurements were taken 300m away from the launch site? What is the difference between warm and analogous colors ? A bicycle tire with a volume of 0.00210 m^3 is filled to its recommended absolute pressure of 495 kPa on a cold winter day when the tire's temperature is -14C. The cyclist then brings his bicycle into a hot laundry room at 32C.a. If the tire warms up while its volume remains constant, will the pressure increase be greater than, less than, or equal to the manufacturer's stated 10% overpressure limit?b. Find the absolute pressure in the tire when it warms to 32 degrees Celcius at constant volume. Genetic diversity is associated with asexual reproduction.TrueFalse Working for a car company, you have been assigned to find the average miles per gallon (mpg) for acertain model of car. you take a random sample of 15 cars of the assigned model. based on previous evidence and a qq plot, you have reason to believe that the gas mileage is normally distributed. you find that the sample average miles per gallon is around 26.7 with a standard deviation of 6.2 mpg.a. Construct and interpret a 95% condence interval for the mean mpg, , for the certain model of car.b. What would happen to the interval if you increased the condence level from 95% to 99%? Explainc. The lead engineer is not happy with the interval you contructed and would like to keep the width of the whole interval to be less than 4 mpg wide. How many cars would you have to sample to create the interval the engineer is requesting? It takes 25 minutes to fry a burger at Jill street, how long will it take to fry 13 burgers You work in an office and one of your co-workers has announced his retirement. You have offered to purchase the retirement gift, so you place a collection jar in the lunch room for anonymous donations to help pay for the gift. After a week you find that very few dollars are in the jar, so you end up paying for a large share of the retirement gift. You are the victim of the: A. common resource problem. B. private good problem. C. overuse of a common resource problem. D. free-rider problem. (x 5) 3 = 2 10 + 8 What Urbanization in Sub-Saharan Africa is _____.decreasingof little importanceincreasingstabilizingdoes the image of a ferretlike face suggest about Mr. Keetch? If the final velocity is 0. third equation of motion will be Im going to introduce my hometown, Phu Tho province, which is located in the North of Vietnam. When you (11. come) ____ there, I would recommend you visit several stunning sights like King Temple or Bac Waterfall, which all (12. become) our honor and pride. You can also experience Phu Thos local specialties such as ear cake or sour meat, which satisfies the travellers desire about cuisine.The atmosphere (13. be) _________ so fresh, and the pace of life (14. be) ________ very slow which (15. give) ________ people a feeling of peace. The people here (16. be) ________ friendly with a warm-hearted attitude that I feel comfortable whenever I (17. come) ______ back.My hometown is becoming more and more vibrant as time (18. go) ______ on. The factories and chain stores has begun opening up, which brings out environmental issues such as air pollution. It is the place that I (19. be) _______ really interested in. Initially, it is my home where my beloved is living there. I personally (20. feel) _________that my hometown is the nicest place that Ive ever known. *40 im A sample of 42 observations is selected from one population with a population standard deviation of 3.3. The sample mean is 101.0. A sample of 53 observations is selected from a second population with a population standard deviation of 3.6. The sample mean is 99.0. Conduct the following test of hypothesis using the 0.04 significance level.H0 : 1 = 2H1 : 1 2a. State the decision rule.b. Compute the value of the test statistic. c. What is your decision regarding H0?d. What is the p-value? The best way to protect your family from carbon monoxide poisoning is to install a whole-house air ventilation system