Ryan, Alec and Amani went to ShopRite to buy boxes of fruit. Ryan bought 2 boxes of strawberries, 1 box of apples, and 4 boxes of blueberries for $34. Alec bought 3 boxes of strawberries, 2 boxes of apples, and 2 boxes of blueberries for $35. Amani bought 5 boxes of strawberries, 3 boxes of apples, and 2 boxes of blueberries for $49. How much does an individual box of strawberries, apples, and blueberries cost?

Answers

Answer 1

Answer:

5.

Step-by-step explanation:

First, we need to add all the number of baskets Ryan bought first. The equation should look something like this;

34÷(2+1+3)

Our answer is 4.8571428571. However, to put it in simplest terms, we can just say 4.85.

Now, we just keep changing up the numbers but with the same division we were using for Ryan's price on the fruit.

Alec's: 35÷(3+2+2)=5

Amani's: 49÷(5+3+2)=4.9

Notice how all the answers we get answers related to 5. If we all round the numbers, we actually get 5!

So, I believe your answer is 5. I'm terribly sorry if I'm incorrect. (If I am, I will try to fix it in the comments for you)


Related Questions

Given the a center (-1, -2) and a radius r = 2. Identify the circle.

Answers

Answer:

1st option

1st graph has the centre on (-1,-2) and the distance of the circumference from the centre is 2

Answered by GAUTHMATH

Solve for x. Enter the solutions from least to greatest. 3x^2-9x-12=0

Lesser x =

Greater x =



I NEED HELP ASAP!!!!!

Answers

Answer:

the answer will be..

x=-1

x=4

(x+1) (x-4)

but im sorry i dunno what's lesser and greater means

SOMEONE PLEASE HELP ME OUT THIS IS DUE In 20 MINUTES (PICTURE)

Answers

9ths answer. 113.112 ~ 113.1

I need help solving

Answers

The answer to ur question is 20. You just need to set it up into proportions

Lines l and m are parallel. When they are cut by the two transversals below, a triangle is formed.

Parallel lines l and m are intersected by lines s and t. A triangle has angles 1, 2, 40 degrees. The exterior angle to angle 1 is 74 degrees.

What is Measure of angle 2
34 degrees
40 degrees
74 degrees
146 degrees

Answers

Answer:

<2 = 34degrees

Step-by-step explanation:

Find the diagram attached below:

First we need to get <1;

<1 + 74 = 180 (angle on a straight line)

<1 = 180 - 74

<1 = 106degrees

Also, <1 + <2 + 40 = 180 (sum of angle in a triangle)

106+<2 + 40 = 180

146 + <2 = 180

<2 = 180-146

<2 = 34degrees

Answer:

34 its the right answer

Step-by-step explanation:

Instructions: Use the ratio of a 30-60-90 triangle to solve for the variables. Leave your
answers as radicals in simplest form.

Answers

Answer:

x =10

y = 10 sqrt(3)/ 3

Step-by-step explanation:

Since this is a right triangle, we can use trig functions

sin theta = opp / hyp

sin 60 = 5 sqrt(3) / x

x sin 60 = 5 sqrt(3)

x = 5 sqrt(3)/sin 60

x = 5 sqrt(3) / sqrt(3)/2

x = 5*2

x =10

tan theta = opp /adj

tan 60 = x/y

ytan 60 = 10

y = x/ tan 60

y = 10/ sqrt(3)

y = 10/ sqrt(3)  * sqrt(3)/ sqrt(3)

y = 10 sqrt(3)/ 3

Cho 6 số thỏa mãn: xa+yb=c ,xb+yc=a, xc+ya=b; abc khác 0

Tính P= [tex]$\frac{a^{2}}{bc}$ + $\frac{b^{2}}{ca}$ + $\frac{c^{2}}{ab}$[/tex]

Answers

Answer:

Step-by-step explanation:

xa+yb=c

xb+yc=a

xc+ya=b

add

x(a+b+c)+y(a+b+c)=a+b+c

x+y=1 ... (1)

xac+ybc=c²

xab+yac=a²

xbc+yab=b²

add

x(ab+bc+ca)+y(ab+bc+ca)=a²+b²+c²

[tex]x+y=\frac{a^2+b^2+c^2}{ab+bc+ca} \\\frac{a^2+b^2+c^2}{ab+bc+ca} =1\\a^2+b^2+c^2=ab+bc+ca\\a^2+b^2+c^2-ab-bc-ca=0\\a^3+b^3+c^3-3abc=(a+b+c)(a^2+b^2+c^2-ab-bc-ca)=(a+b+c)(0)=0\\a^3+b^3+c^3=3abc\\\frac{a^3}{abc} +\frac{b^3}{abc} +\frac{c^3}{abc} =3\\\frac{a^2}{bc} +\frac{b^2}{ca} +\frac{c^2}{ab} =3[/tex]

Find m angle AFE.


Please I need help badly

Answers

It’s 173. Add all the given angles and so AFD is 116. Then you can see that angle DFE has the same angle marking as BFC which means they must have the same measure. So 116+57=173. Hope this helps.

The measure of the angle AFE or m∠AFE is 173 degrees option (B) 173 is correct if the angle AFB = 25 degrees, Angle BFC = 57 degrees, Angle CFD = 34 degrees, and Angle DFE = 57 degrees.

What is an angle?

When two lines or rays converge at the same point, the measurement between them is called a "Angle."

We have angles shown in the picture.

Angle AFB = 25 degrees

Angle BFC = 57 degrees

Angle CFD = 34 degrees

Angle DFE = 57 degrees

Angle AFE is the sum of the angle AFB, Angle BFC, Angle CFD, and Angle DFE.

Angle AFE = Angle AFB + Angle BFC + Angle CFD + Angle DFE

Angle AFE = 25 + 57 + 34 + 57

Angle AFE = 173 degrees

Thus, the measure of the angle AFE or m∠AFE is 173 degrees option (B) 173 is correct if the angle AFB = 25 degrees, Angle BFC = 57 degrees, Angle CFD = 34 degrees, and Angle DFE = 57 degrees.

Learn more about the angle here:

brainly.com/question/7116550

#SPJ5


At Tubman Middle School, there are 6 English teachers and 5 science teachers. If each
student takes one English class and one science class how many possible combinations of
teachers are there?

Answers

There are 30 possible combinations of teachers.

Given that at Tubman Middle School, there are 6 English teachers and 5 science teachers, to determine, if each student takes one English class and one science class, how many possible combinations of teachers are there, the following calculation must be performed:

To calculate possible combinations, the number of options A must be multiplied by the number of options B. Thus, the calculation would be as follows.

6 x 5 = X30 = X

Therefore, there are 30 possible combinations of teachers.

Learn more about combinations in https://brainly.com/question/24180105.

y = –2x2 - 4x – 6 has how many real roots?

Answers

Answer:

Step-by-step explanation:

None

They are both imaginary or complex. You can check that out by calculating the discriminate. If you get a minus answer, then there are no real roots. Let's try it.

a = - 2

b = - 4

c = - 6

D = sqrt(b^2 - 4*a * c)

D = sqrt( (-4)^2 - 4*(-2)(-6)  )

D = sqrt( 16 - 48)

D = sqrt(-32) which is negative and there are no real roots.

please help!!!! i need it in this instant!!!

Answers

Answer: 14

Step-by-step explanation:

If they hit the ball 4/8 times, that equals 1/2, so we just multiply 1/2 (or 0.5) by 28 and you get 14 :)

14 is your answer!
Hope this helps!!!!!

Which functions have a maximum value greater than the maximum of the function g(x) = -(x + 3)2 - 4?

Answers

Answer:

max: -4

Step-by-step explanation:

(x+3)^2 》0 mọi x

<=> -(x+3)^2 《0

<=> -(x+3)^2 -4 《 -4

What is the possible answer?

Answers

Standard form of a quadratic equation: ax^2 + bx + c = 0

3x - 4 = -x^2

x^2 + 3x - 4 = 0

Hope this helps!

simplify
[tex] \sqrt[6]{5} \times \sqrt[2]{5} = [/tex]
sumplify

Answers

Step-by-step explanation:

[tex] \sqrt[6]{5} \times \sqrt[2]{5} [/tex]

[tex] = {5}^{ \frac{1}{6} } \times {5}^{ \frac{1}{2} } [/tex]

[tex] = {5}^{ \frac{1}{6} + \frac{1}{2} } [/tex]

[tex] = {5}^{ \frac{1 + 3}{6} } [/tex]

[tex] = {5}^{ \frac{4}{6} } [/tex]

[tex] = {5}^{ \frac{2}{3} } [/tex]

[tex] = \sqrt[3]{ {5}^{2} } (ans)[/tex]

Write an equation of a circle given the center (-4,4) and radius r=5

Answers

Answer:

Step-by-step explanation:

Equation of circle: (x - h)² + (y - k)² = r²   where (h,k) is the center.

Center( -4 , 4) and r = 5

(x -[-4])² + (y - 4)²= 5²

(x + 4)² + (y-4)² = 25

x²  + 2*4*x +4²  + y²  - 2*y*4 + 4²  = 25

x²  +8x + 16 + y²  - 8y + 16 = 25

x²  + 8x + y²  - 8y + 16 + 16 -25 = 0

x²  + 8x + y²  - 8y +7 = 0

We have that the an equation of a circle given the center (-4,4) and radius r=5  is mathematically given as

(x-4)^2+(y-4)^2=5^2

Equation of a circle

Question Parameters:

Given the center (-4,4) and radius r=5

Generally the equation for the Equation of a circle   is mathematically given as

(x-x')^2+(y-y')^2=r^2

Therefore, The resultant equation will be

(x-x')^2+(y-y')^2=r^2

(x-4)^2+(y-4)^2=5^2

Hence,an equation of a circle given the center (-4,4) and radius r=5 is

(x-4)^2+(y-4)^2=5^2

For more information on Equation visit

https://brainly.com/question/2263981

what ia measurement in science​

Answers

Answer:

In science, a measurement is quantitative (in terms is which is heavier, lighter, fast, slow and all) or numerical data(numbers like 1m,1cm) that describes a property of an object or event.

work out the area of a semicircle take pi to be 3.142 11cm

Answers

Answer:

if the diameter is 11, them the answer is 47.52275cm

if n(u) = 800. n(a) = 400. n(b) = 300 n(āūb) = 200 what is n(anb) and n(a)

Answers

Here is the answer !
If n (u) = 800. n(a)=400.n(b) =300n(sub)=200
Ans =300

Can anyone help pls :)? Thank you

Answers

Answer: 6

Explanation: The EXACT calculation would be 5.9215.. so the closest approximation would be
6, as it's only about .08 -ish away from 6.

Answer:

It's D:5.3

Step-by-step explanation:

√28 =5.29

Round off therefore is 5.3

Solve the system of equations and choose the correct ordered pair.
4x - 2y = -2
6x + 3y = 27
A. (2,5)
B. (3,7)
C. (0, -1)
D. (0,9)

Answers

Answer:

(2,5)

Step-by-step explanation:

4x - 2y = -2

6x + 3y = 27

Divide the first equation by 2 and the second equation by 3

2x - y = -1

2x + y = 9

Add the equations together

2x - y = -1

2x + y = 9

-------------------

4x = 8

Divide by 4

4x/4 = 8/2

x =2

2x+y = 9

2(2) +y = 9

4+u = 9

y = 9-4

y=5

(2,5)

Drag the tiles to the boxes to form correct pairs. Not all tiles will be used. Match each set of vertices with the type of quadrilateral they form.

Answers

I'm sorry but there's not enough info

Step-by-step explanation:

Answer:

The triangle with vertices A (2 , 0) , B (3 , 2) , C (5 , 1) is isosceles right Δ

The triangle with vertices A (-3 , 1) , B (-3 , 4) , C (-1 , 1) is right Δ

The triangle with vertices A (-5 , 2) , B (-4 , 4) , C (-2 , 2) is acute scalene Δ

The triangle with vertices A (-4 , 2) , B (-2 , 4) , C (-1 , 4) is obtuse scalene Δ

Could someone please help? I’ve done this lesson so many times and still struggle.

Answers

Nice job on getting problem 1 correct.

=================================================

Problem 2

The double stem and leaf plot says we have the following data set for the men's side

53,54,57 60,61,62,63,63,64,64,66,67,67,68,69 70,70,70,70,70,73,76,77,77,77,77,79 81,82,85,86,88,88 90,92,93,98

Be careful to read the stem first, followed by the leaf (even though the leaf values are listed on the left side of the stem).

Notice how each row is a different stem (in this case, tens digit) to help make things more readable.

If we were to add up all of those values I listed above, then we should get the sum 2707. Divide this over n = 37 to get 2707/n = 2707/37 = 73.162 approximately. This rounds to 73 since your teacher wants you to round to the nearest whole point.

The average score for the men is 73.

You'll do the same thing for the women's side. That data set is

55,59 60,60,62,62,63,64,65,66,66,67 70,71,71,72,73,74,75,76,79,79 80,81,82,83,83,84,89 90,92,92,93,93,95,98 100

Again, it's handy to break the scores up by stem or else you'll have a long string of scores to get lost in (or it's easier to get lost in).

Adding up those 37 scores should get you 2824 which then leads to a mean of 2824/n = 2824/37 = 76.324 approximately. This rounds to 76

The average score for the women is 76.

=================================================

Problem 3

The range for the men is max - min = 98 - 53 = 45

The range for the women is max - min = 100 - 55 = 45

Both groups have the same range (which is 45)

==================================================

Problem 4

It's strongly recommended to use a spreadsheet here. Let's focus on the men's data set.

The idea is to subtract each data value from the mean 73.162, and then square the result. So each term is of the form (x-mu)^2 where mu is the mean.

For example, the data value x = 53 on the men's side will lead to

(x-mu)^2 = (53 - 73.162)^2 = 406.506

We consider this a squared error value.

You'll do this with the remaining 36 other values in the men's data set.

After doing this, you'll add up the 37 items in this new column and you should get roughly 4711.027, and this is the sum of the squared errors (SSE).

Divide this over n = 37 and we get 4711.027/37 = 127.325

Lastly, apply the square root and we arrive at sqrt(127.325) = 11.284 which rounds to 11.28

The steps for the women's standard deviation will be the same. You should get 12.30

-------------

Answers:Men's standard deviation = 11.28Women's standard deviation = 12.30

These are population standard deviation values. If you don't want to use a spreadsheet, a much better option is to use online calculators that specialize in population standard deviation.

1) The men's and women's team each played 37 games.

2) the mean score of men's and women's team is 73 and 76 approximately.

3) the range of men's and women's score is 45.

4)the standard deviation of men and women team 11 and 12 approximately.

Number of observations can be found by counting the observations.

Mean is the average of all observations. It is the sum product of observations divided by the number of observations.

The range of observations is the measure of spread. It is the highest value minus the lowest value.

The standard deviation is another measure of variability. It is the square root of variance, where variance is the sumproduct of observations minus the mean, divided by the number of observations.

The data set is given by:

Men's team

53,54,5760,61,62,63,63,64,64,66,67,67,68,6970,70,70,70,70,73,76,77,77,77,77,7981,82,85,86,88,8890,92,93,98

Women's team

55,5960,60,62,62,63,64,65,66,66,6770,71,71,72,73,74,75,76,79,7980,81,82,83,83,84,8990,92,92,93,93,95,98100

1) Number of games each team played :

men's team = 37

women's team = 37

2)mean = [tex]\frac{sum \ of \ observations}{number \ of \ observations}[/tex]

men's team = [tex]\frac{2707}{37}[/tex] =  = 73.162

women's team = [tex]\frac{2824}{37}[/tex]  =  = 76.324

3)range =  highest observation - lowest observation

men's team = 98 - 53 = 45

women's team = 100 - 55 = 45

4)population standard deviation = [tex]\sqrt{ \frac{\sum (x-\bar x)^2}{n}}[/tex]

On using the formula :

men's team = [tex]\sqrt{\frac{4711.027}{37} } = \sqrt{127.325} = 11.284[/tex]

women's team = [tex]\sqrt{151.29}[/tex] = 12.3

Learn more about mean here

https://brainly.com/question/31101410

#SPJ2

Jeremy is buying a new car. The total cost, including tax, is $18275. If the tax rate is 7.5% , what is the sticker price of the car?

Answers

Answer:

$17000

Step-by-step explanation:

Given

[tex]Total = 18275[/tex]

[tex]Tax = 7.5\%[/tex]

Required

The original price

This is calculated using:

[tex]Price(1 + Tax) = Total[/tex]

Make Price the subject

[tex]Price = \frac{Total}{(1 + Tax)}[/tex]

So, we have:

[tex]Price = \frac{18275}{(1 + 7.5\%)}[/tex]

[tex]Price = \frac{18275}{1.075}[/tex]

[tex]Price = 17000[/tex]

Find the product (x - 10) ( x - 5)​

Answers

꙰  Hello there mohammedsaquibali45 ! My Name is ⚝Tobie⚝ and I'm glad you asked! Let me walk you step by step in order to comprehend the question better!   ꙰  

i

{x}^{2}-5x-10x+50

x

2

−5x−10x+50

ii Collect like terms.

{x}^{2}+(-5x-10x)+50

x

2

+(−5x−10x)+50

iii Simplify.

{x}^{2}-15x+50

x

2

−15x+50

☆Answer :

(x - 10)(x - 5) = ...

= x^2 + (-10 + (-5))x + (-10•(-5))

= x^2 - 15x + 50

x.(9x-1).(x+2)-x(3x-1).(3x+1)

Answers

Answer:

=17x²-x

Step-by-step explanation:

=x.(9x²+18x-x-2)-x.(9x²-1)

=x.(9x²+17x-2-9x²+1)

=x.(17x-1)

=17x²-x

Describe the steps to dividing imaginary numbers and complex numbers with two terms in the denominator?

Answers

Answer:

Let be a rational complex number of the form [tex]z = \frac{a + i\,b}{c + i\,d}[/tex], we proceed to show the procedure of resolution by algebraic means:

1) [tex]\frac{a + i\,b}{c + i\,d}[/tex]   Given.

2) [tex]\frac{a + i\,b}{c + i\,d} \cdot 1[/tex] Modulative property.

3) [tex]\left(\frac{a+i\,b}{c + i\,d} \right)\cdot \left(\frac{c-i\,d}{c-i\,d} \right)[/tex]   Existence of additive inverse/Definition of division.

4) [tex]\frac{(a+i\,b)\cdot (c - i\,d)}{(c+i\,d)\cdot (c - i\,d)}[/tex]   [tex]\frac{x}{y}\cdot \frac{w}{z} = \frac{x\cdot w}{y\cdot z}[/tex]  

5) [tex]\frac{a\cdot (c-i\,d) + (i\,b)\cdot (c-i\,d)}{c\cdot (c-i\,d)+(i\,d)\cdot (c-i\,d)}[/tex]  Distributive and commutative properties.

6) [tex]\frac{a\cdot c + a\cdot (-i\,d) + (i\,b)\cdot c +(i\,b) \cdot (-i\,d)}{c^{2}-c\cdot (i\,d)+(i\,d)\cdot c+(i\,d)\cdot (-i\,d)}[/tex] Distributive property.

7) [tex]\frac{a\cdot c +i\,(-a\cdot d) + i\,(b\cdot c) +(-i^{2})\cdot (b\cdot d)}{c^{2}+i\,(c\cdot d)+[-i\,(c\cdot d)] +(-i^{2})\cdot d^{2}}[/tex] Definition of power/Associative and commutative properties/[tex]x\cdot (-y) = -x\cdot y[/tex]/Definition of subtraction.

8) [tex]\frac{(a\cdot c + b\cdot d) +i\cdot (b\cdot c -a\cdot d)}{c^{2}+d^{2}}[/tex] Definition of imaginary number/[tex]x\cdot (-y) = -x\cdot y[/tex]/Definition of subtraction/Distributive, commutative, modulative and associative properties/Existence of additive inverse/Result.

Step-by-step explanation:

Let be a rational complex number of the form [tex]z = \frac{a + i\,b}{c + i\,d}[/tex], we proceed to show the procedure of resolution by algebraic means:

1) [tex]\frac{a + i\,b}{c + i\,d}[/tex]   Given.

2) [tex]\frac{a + i\,b}{c + i\,d} \cdot 1[/tex] Modulative property.

3) [tex]\left(\frac{a+i\,b}{c + i\,d} \right)\cdot \left(\frac{c-i\,d}{c-i\,d} \right)[/tex]   Existence of additive inverse/Definition of division.

4) [tex]\frac{(a+i\,b)\cdot (c - i\,d)}{(c+i\,d)\cdot (c - i\,d)}[/tex]   [tex]\frac{x}{y}\cdot \frac{w}{z} = \frac{x\cdot w}{y\cdot z}[/tex]  

5) [tex]\frac{a\cdot (c-i\,d) + (i\,b)\cdot (c-i\,d)}{c\cdot (c-i\,d)+(i\,d)\cdot (c-i\,d)}[/tex]  Distributive and commutative properties.

6) [tex]\frac{a\cdot c + a\cdot (-i\,d) + (i\,b)\cdot c +(i\,b) \cdot (-i\,d)}{c^{2}-c\cdot (i\,d)+(i\,d)\cdot c+(i\,d)\cdot (-i\,d)}[/tex] Distributive property.

7) [tex]\frac{a\cdot c +i\,(-a\cdot d) + i\,(b\cdot c) +(-i^{2})\cdot (b\cdot d)}{c^{2}+i\,(c\cdot d)+[-i\,(c\cdot d)] +(-i^{2})\cdot d^{2}}[/tex] Definition of power/Associative and commutative properties/[tex]x\cdot (-y) = -x\cdot y[/tex]/Definition of subtraction.

8) [tex]\frac{(a\cdot c + b\cdot d) +i\cdot (b\cdot c -a\cdot d)}{c^{2}+d^{2}}[/tex] Definition of imaginary number/[tex]x\cdot (-y) = -x\cdot y[/tex]/Definition of subtraction/Distributive, commutative, modulative and associative properties/Existence of additive inverse/Result.

√25x+75 +3√x-2 =2+4√x-3 +√9x-18

Answers

Answer: No solutions

Step-by-step explanation:

[tex]\large \bf \boldsymbol{ \boxed{\sqrt{a}\cdot \sqrt{b}=\sqrt{a\cdot b} }} \\\\\\ \sqrt{25x+75} +3\sqrt{x-2} =2+4\sqrt{x-3} +\sqrt{9x-18} \\\\ \sqrt{25} \cdot \sqrt{x+3}+3\sqrt{x-2} =2+4\sqrt{x-3} +\sqrt{9}\cdot \sqrt{x-2} \\\\5\sqrt{x+3} +3\sqrt{x-2} \!\!\!\!\!\!\!\!\!\!\bigg{/} \ \ =2 +4\sqrt{x-3} +3\sqrt{x-2} \!\!\!\!\!\!\!\!\!\!\bigg{/} \\\\(5\sqrt{x+3})^2 =(2+4\sqrt{x-3} )^2 \\\\ \ \ \ let \ \ t=x+3 \ \ ; \ \ \ t-6=x-3 \\\\ \big(5\sqrt{t} \ \big)^2=(2+\sqrt{t-6} )^2 \\\\[/tex]                                   [tex]\large \boldsymbol{} \bf 25t=4+16\sqrt{t-6} +16(t-6) \\\\(9t+92)^2=(16\sqrt{t-6} )^2 \\\\81t^2+1656t+8464=256(t-6)\\\\81t^2+1400t+10000=0 \\\\ D=1400^2-324000=-128000=> \\\\D<0 \ \ no \ \ solutions[/tex]

Round off all these
1) 378811,
2) 267988,
3) 250260,
4) 196596,
5) 193171
to the nearest ten thousand

Answers

Answer:

1. 380,0002. 270,0003. 250,0004. 200,0005. 190,000

[tex]\tt{ \green{P} \orange{s} \red{y} \blue{x} \pink{c} \purple{h} \green{i} e}[/tex]

378811=380000267988=270000250260=250000196596=200000193171=200000

What is the equation of a parabola that has a vertical axis, passes through the point (–1, 3), and has its vertex at (3, 2)?

= –216+616–4116


= –216+616–4116


=216–616+4116


=216–616+4116

Answers

Answer: y= x^2/16-6x/16+41/16

Step-by-step explanation:

The equation of a parabola will be; y = x^2/16 - 6x/16 + 41/16

What is vertex form of a quadratic equation?

If a quadratic equation is written in the form

y=a(x-h)^2 + k

then it is called to be in vertex form. It is called so because when you plot this equation's graph, you will see vertex point(peak point) is on (h,k)

Otherwise, we had to use calculus to get critical points, then second derivative of functions to find the character of critical points as minima or maxima or saddle etc to get the location of vertex point.

This point (h,k) is called the vertex of the parabola that quadratic equation represents.

WE need to find the equation of a parabola that has a vertical axis, passes through the point (–1, 3), and has its vertex at (3, 2)

Thus, the equation of a parabola will be;

y = x^2/16 - 6x/16 + 41/16

Learn more about vertex form of a quadratic equation here:

https://brainly.com/question/9912128

#SPJ2

In Exercises 51−56, the letters a, b, and c represent nonzero constants. Solve the equation for x

x + a = ¾

Answers

Answer:

x = ¾-a

Step-by-step explanation:

x + a = ¾

Subtract a from each side

x + a -a= ¾-a

x = ¾-a

▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓

[tex]x+a=\dfrac{3}{4}\\\\x=\dfrac{3}{4}-a\\\\x=\dfrac{3-4a}{4}[/tex]

▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓▓

Other Questions
BOYS AND GIRLS, HELP ME PLEASE!!5,6,7,8 PLEASEfactor this examples Calculate the numerical value of the equilibrium constant, Kc, for the reaction below if the equilibrium concentrations for CO, H2 , CH4 and H2O are 0.989 M, 0.993 M, 1.078 M and 0.878 M, respectively. (calculate your answer to three sig figs)CO(g) + 3 H2(g) CH4(g) + H2O(g) Which of the following statements is False. A. Correlational research can be used to study naturally occurring variables.B. Correlations tell researchers about the strength and direction of relationships between variables C. Correlations can be used to establish cause-and- effect relationships between variables D. Correlational research can be conducted either in the laboratory or in the field Enter the solutions from least to greatest.f(x) = (x 3)(2x 8) How many electrons will one atom of element with 6 protons and 9 neutrons . give an explanation of tundra sin(180+0).cos(180+0)/cos(180+0).sin(180-0) Is velocity ratio of a machine affected by applying oil on it?Explain with reason. rope price of length 45cm 25 cm and 81 cm have to be cut into same size pieces what is the smallest price length possible Complete the table to investigate dilations ofexponential functions.3.2*23x-2NAN62-12 / 0ab1d.ef241264a =bef=d =DONEIntro What are three things that all 50 state governments have in common? 18. A triangle has side lengths of 6, 8, and 9. What type of triangle is it?acuteobtuseequiangularright How do feedback mechanisms help maintain homeostasis? The pre-australopith fossils are especially significant because they challenge some of the long-standing explanations of our evolutionary history. Describe two reasons the pre-australopiths force us to rethink the savanna hypothesis in particular. (Hint: Think about the anatomical traits of the pre-australopiths and the environmental and temporal context in which they lived.) The decomposition of ammonia is: 2 NH3(g) N2(g) + 3 H2(g). If Kp is 1.5 103 at 400C, what is the partial pressure of ammonia at equilibrium when N2 is 0.20 atm and H2 is 0.15 atm? What is the distance between the points (7, 8) and (-8, 0) on a coordinate grid? Many immigrants at the turn of the twentieth century came to the United States to escape religious persecution in their homelands. This is an example of what concept?assimilationpush-pull factorcultural shocknativism Two cars start moving from the same point. One travels south at 24 mi/h and the other travels west at 18 mi/h. At what rate (in mi/h) is the distance between the cars increasing two hours later How would the following triangle be classified?O scalene acuteO scalene obtuseO isosceles acuteO isosceles obtuse A rock is dropped from a height of 100 feet calculate the time between when the rock was strong and when he landed if we choose down as positive and ignore air friction the function is h(t)=16t^2-100